C12H15BClN3O2 — CID 75486700
6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole (PubChem CID 75486700) has the molecular formula C12H15BClN3O2 and a molecular weight of 279.54 g/mol. Its IUPAC name is 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole.
| Compound Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole |
|---|---|
| PubChem CID | 75486700 |
| Molecular Formula | C12H15BClN3O2 |
| Molecular Weight | 279.54 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole |
| SMILES | CC1(C)OB(c2cc(Cl)cc3n[nH]nc23)OC1(C)C |
| InChI | InChI=1S/C12H15BClN3O2/c1-11(2)12(3,4)19-13(18-11)8-5-7(14)6-9-10(8)16-17-15-9/h5-6H,1-4H3,(H,15,16,17) |
| InChIKey | MTISJOFKAKLQAI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|