C16H18BNO4S — CID 75486944
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 75486944) has the molecular formula C16H18BNO4S and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 75486944 |
| Molecular Formula | C16H18BNO4S |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(-c3nc(C(=O)O)cs3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H18BNO4S/c1-15(2)16(3,4)22-17(21-15)11-7-5-10(6-8-11)13-18-12(9-23-13)14(19)20/h5-9H,1-4H3,(H,19,20) |
| InChIKey | CFATZSQTZLYJHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|