C17H23BN2O4 — CID 75487488
1-ethyl-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole-5-carboxylic acid (PubChem CID 75487488) has the molecular formula C17H23BN2O4 and a molecular weight of 330.19 g/mol. Its IUPAC name is 1-ethyl-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-ethyl-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 75487488 |
| Molecular Formula | C17H23BN2O4 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-ethyl-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole-5-carboxylic acid |
| SMILES | CCn1c(C)nc2cc(C(=O)O)cc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C17H23BN2O4/c1-7-20-10(2)19-13-9-11(15(21)22)8-12(14(13)20)18-23-16(3,4)17(5,6)24-18/h8-9H,7H2,1-6H3,(H,21,22) |
| InChIKey | KHWCEJOCNSPDOT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|