C18H29BClNO3 — CID 75487668
4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]morpholine;hydrochloride (PubChem CID 75487668) has the molecular formula C18H29BClNO3 and a molecular weight of 353.70 g/mol. Its IUPAC name is 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]morpholine;hydrochloride.
| Compound Name | 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 75487668 |
| Molecular Formula | C18H29BClNO3 |
| Molecular Weight | 353.70 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]morpholine;hydrochloride |
| SMILES | CC(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N1CCOCC1.Cl |
| InChI | InChI=1S/C18H28BNO3.ClH/c1-14(20-10-12-21-13-11-20)15-6-8-16(9-7-15)19-22-17(2,3)18(4,5)23-19;/h6-9,14H,10-13H2,1-5H3;1H |
| InChIKey | LJPAEWWOVCJFHW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|