About 2-amino-1,3-benzoxazole-5-carbaldehyde
2-amino-1,3-benzoxazole-5-carbaldehyde (PubChem CID 75488501) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 2-amino-1,3-benzoxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-amino-1,3-benzoxazole-5-carbaldehyde |
| PubChem CID | 75488501 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-amino-1,3-benzoxazole-5-carbaldehyde |
| SMILES | Nc1nc2cc(C=O)ccc2o1 |
| InChI | InChI=1S/C8H6N2O2/c9-8-10-6-3-5(4-11)1-2-7(6)12-8/h1-4H,(H2,9,10) |
| InChIKey | WMXJKPPSXBAGSI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,3-benzoxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-benzoxazole-5-carbaldehyde?
The IUPAC name of 2-amino-1,3-benzoxazole-5-carbaldehyde (CID 75488501) is 2-amino-1,3-benzoxazole-5-carbaldehyde.
What is the SMILES notation for 2-amino-1,3-benzoxazole-5-carbaldehyde?
The canonical SMILES for 2-amino-1,3-benzoxazole-5-carbaldehyde is Nc1nc2cc(C=O)ccc2o1.
What is the InChIKey of 2-amino-1,3-benzoxazole-5-carbaldehyde?
The InChIKey is WMXJKPPSXBAGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c9-8-10-6-3-5(4-11)1-2-7(6)12-8/h1-4H,(H2,9,10).
What are the key properties of 2-amino-1,3-benzoxazole-5-carbaldehyde?
2-amino-1,3-benzoxazole-5-carbaldehyde has a molecular weight of 162.15 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-benzoxazole-5-carbaldehyde is sourced from PubChem (CID 75488501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).