About 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride
6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride (PubChem CID 75488555) has the molecular formula C7H5ClF2N2O
and a molecular weight of 206.58 g/mol. Its IUPAC name is 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride |
| PubChem CID | 75488555 |
| Molecular Formula | C7H5ClF2N2O |
| Molecular Weight | 206.58 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride |
| SMILES | Cl.Nc1nc2ccc(F)c(F)c2o1 |
| InChI | InChI=1S/C7H4F2N2O.ClH/c8-3-1-2-4-6(5(3)9)12-7(10)11-4;/h1-2H,(H2,10,11);1H |
| InChIKey | HKYXWNKQOUABTQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride?
The IUPAC name of 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride (CID 75488555) is 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride.
What is the SMILES notation for 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride?
The canonical SMILES for 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride is Cl.Nc1nc2ccc(F)c(F)c2o1.
What is the InChIKey of 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride?
The InChIKey is HKYXWNKQOUABTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2N2O.ClH/c8-3-1-2-4-6(5(3)9)12-7(10)11-4;/h1-2H,(H2,10,11);1H.
What are the key properties of 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride?
6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride has a molecular weight of 206.58 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-1,3-benzoxazol-2-amine;hydrochloride is sourced from PubChem (CID 75488555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).