C19H29N5O — CID 75489615
N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide (PubChem CID 75489615) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
|---|---|
| PubChem CID | 75489615 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
| SMILES | CC1(C)CC(NC(=O)CCCc2nnc3ccccn23)CC(C)(C)N1 |
| InChI | InChI=1S/C19H29N5O/c1-18(2)12-14(13-19(3,4)23-18)20-17(25)10-7-9-16-22-21-15-8-5-6-11-24(15)16/h5-6,8,11,14,23H,7,9-10,12-13H2,1-4H3,(H,20,25) |
| InChIKey | OHXVBILBVHSUBF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |