C17H13N3O4S — CID 75489722
2-[4-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)phenoxy]acetamide (PubChem CID 75489722) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-[4-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)phenoxy]acetamide.
| Compound Name | 2-[4-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 75489722 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-[4-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C2CC(=O)Oc3ccc4nsnc4c32)cc1 |
| InChI | InChI=1S/C17H13N3O4S/c18-14(21)8-23-10-3-1-9(2-4-10)11-7-15(22)24-13-6-5-12-17(16(11)13)20-25-19-12/h1-6,11H,7-8H2,(H2,18,21) |
| InChIKey | UZASYEAVPJVIEU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|