C17H15ClN4O — CID 75489736
N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pyrazine-2-carboxamide (PubChem CID 75489736) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 75489736 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCc2c1[nH]c1c(Cl)cccc21)c1cnccn1 |
| InChI | InChI=1S/C17H15ClN4O/c18-12-5-1-3-10-11-4-2-6-13(16(11)22-15(10)12)21-17(23)14-9-19-7-8-20-14/h1,3,5,7-9,13,22H,2,4,6H2,(H,21,23) |
| InChIKey | WSZPDZLCESJXJU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|