C20H12N2O5S — CID 75489800
3-[5-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)furan-2-yl]benzoic acid (PubChem CID 75489800) has the molecular formula C20H12N2O5S and a molecular weight of 392.39 g/mol. Its IUPAC name is 3-[5-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)furan-2-yl]benzoic acid.
| Compound Name | 3-[5-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 75489800 |
| Molecular Formula | C20H12N2O5S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-[5-(7-oxo-8,9-dihydropyrano[2,3-g][2,1,3]benzothiadiazol-9-yl)furan-2-yl]benzoic acid |
| SMILES | O=C1CC(c2ccc(-c3cccc(C(=O)O)c3)o2)c2c(ccc3nsnc23)O1 |
| InChI | InChI=1S/C20H12N2O5S/c23-17-9-12(18-16(27-17)5-4-13-19(18)22-28-21-13)15-7-6-14(26-15)10-2-1-3-11(8-10)20(24)25/h1-8,12H,9H2,(H,24,25) |
| InChIKey | UPWSVGKEHSTVNM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|