C23H21N3O2 — CID 75489945
1-methyl-2-oxo-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)quinoline-4-carboxamide (PubChem CID 75489945) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)quinoline-4-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 75489945 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-methyl-2-oxo-N-(2,3,4,9-tetrahydro-1H-carbazol-1-yl)quinoline-4-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)NC2CCCc3c2[nH]c2ccccc32)c2ccccc21 |
| InChI | InChI=1S/C23H21N3O2/c1-26-20-12-5-3-8-15(20)17(13-21(26)27)23(28)25-19-11-6-9-16-14-7-2-4-10-18(14)24-22(16)19/h2-5,7-8,10,12-13,19,24H,6,9,11H2,1H3,(H,25,28) |
| InChIKey | NTDFODQYKQSXEV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|