C13H11FN4O2S2 — CID 75490284
3-[3-(3-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide (PubChem CID 75490284) has the molecular formula C13H11FN4O2S2 and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[3-(3-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[3-(3-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 75490284 |
| Molecular Formula | C13H11FN4O2S2 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-[3-(3-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nn3c(-c4cccc(F)c4)nnc3s2)C1 |
| InChI | InChI=1S/C13H11FN4O2S2/c14-10-3-1-2-8(6-10)11-15-16-13-18(11)17-12(21-13)9-4-5-22(19,20)7-9/h1-3,6,9H,4-5,7H2 |
| InChIKey | HUEGVQQJCCEXKF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |