C18H12F2N2O4 — CID 75490796
4-[3-(difluoromethoxy)phenyl]-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione (PubChem CID 75490796) has the molecular formula C18H12F2N2O4 and a molecular weight of 358.30 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)phenyl]-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione.
| Compound Name | 4-[3-(difluoromethoxy)phenyl]-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione |
|---|---|
| PubChem CID | 75490796 |
| Molecular Formula | C18H12F2N2O4 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[3-(difluoromethoxy)phenyl]-7-oxa-1,9-diazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,6-dione |
| SMILES | O=C1CC(c2cccc(OC(F)F)c2)c2c(nc3ccccn3c2=O)O1 |
| InChI | InChI=1S/C18H12F2N2O4/c19-18(20)25-11-5-3-4-10(8-11)12-9-14(23)26-16-15(12)17(24)22-7-2-1-6-13(22)21-16/h1-8,12,18H,9H2 |
| InChIKey | XJLUQBORHGRQPI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |