C29H19NO11 — CID 75491185
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 75491185) has the molecular formula C29H19NO11 and a molecular weight of 557.47 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 75491185 |
| Molecular Formula | C29H19NO11 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cc3cc4c(cc3[nH]c2=O)OCCO4)c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C29H19NO11/c31-16-2-1-11(6-17(16)32)27-26(36)25(35)24-18(33)10-21-23(28(24)41-27)13(8-22(34)40-21)14-5-12-7-19-20(39-4-3-38-19)9-15(12)30-29(14)37/h1-2,5-7,9-10,13,31-33,36H,3-4,8H2,(H,30,37) |
| InChIKey | INXXDSIIBTTXSG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|