C26H17ClO10 — CID 75491206
10-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 75491206) has the molecular formula C26H17ClO10 and a molecular weight of 524.87 g/mol. Its IUPAC name is 10-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 10-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 75491206 |
| Molecular Formula | C26H17ClO10 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 10-(6-chloro-4H-1,3-benzodioxin-8-yl)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cc(Cl)cc3c2OCOC3)c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C26H17ClO10/c27-12-3-11-8-34-9-35-24(11)14(5-12)13-6-19(31)36-18-7-17(30)21-22(32)23(33)25(37-26(21)20(13)18)10-1-2-15(28)16(29)4-10/h1-5,7,13,28-30,33H,6,8-9H2 |
| InChIKey | MFKONQFDLJACHR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|