C24H15N3O8 — CID 75491609
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-pyrazolo[1,5-a]pyrimidin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 75491609) has the molecular formula C24H15N3O8 and a molecular weight of 473.40 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-pyrazolo[1,5-a]pyrimidin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-pyrazolo[1,5-a]pyrimidin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 75491609 |
| Molecular Formula | C24H15N3O8 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-10-pyrazolo[1,5-a]pyrimidin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cnn3cccnc23)c2c(cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C24H15N3O8/c28-13-3-2-10(6-14(13)29)22-21(33)20(32)19-15(30)8-16-18(23(19)35-22)11(7-17(31)34-16)12-9-26-27-5-1-4-25-24(12)27/h1-6,8-9,11,28-30,33H,7H2 |
| InChIKey | IBZIDKRDICLJMD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|