C20H23N5O3S — CID 75492217
N-[(3S)-3-(2-methylsulfanylethyl)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-7-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 75492217) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(3S)-3-(2-methylsulfanylethyl)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-7-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(3S)-3-(2-methylsulfanylethyl)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-7-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 75492217 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[(3S)-3-(2-methylsulfanylethyl)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-7-yl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CSCC[C@@H]1NC(=O)c2cc(NC(=O)c3n[nH]c4c3CCCC4)ccc2NC1=O |
| InChI | InChI=1S/C20H23N5O3S/c1-29-9-8-16-19(27)22-14-7-6-11(10-13(14)18(26)23-16)21-20(28)17-12-4-2-3-5-15(12)24-25-17/h6-7,10,16H,2-5,8-9H2,1H3,(H,21,28)(H,22,27)(H,23,26)(H,24,25)/t16-/m0/s1 |
| InChIKey | GCJOSWWOZVGEBN-INIZCTEOSA-N |
| XLogP | 2.34 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |