C35H28O11 — CID 75492482
10-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-4-methoxyphenyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 75492482) has the molecular formula C35H28O11 and a molecular weight of 624.60 g/mol. Its IUPAC name is 10-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-4-methoxyphenyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 10-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-4-methoxyphenyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 75492482 |
| Molecular Formula | C35H28O11 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 10-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-4-methoxyphenyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(C2CC(=O)Oc3cc(O)c4c(=O)c(O)c(-c5ccc(O)c(O)c5)oc4c32)cc1OCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C35H28O11/c1-42-26-7-4-18(14-27(26)44-10-8-17-2-6-25-19(12-17)9-11-43-25)21-15-29(39)45-28-16-24(38)31-32(40)33(41)34(46-35(31)30(21)28)20-3-5-22(36)23(37)13-20/h2-7,12-14,16,21,36-38,41H,8-11,15H2,1H3 |
| InChIKey | XLRHKPTXMXNAGC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|