C32H29NO10 — CID 75492526
methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]propanoate (PubChem CID 75492526) has the molecular formula C32H29NO10 and a molecular weight of 587.58 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]propanoate.
| Compound Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]propanoate |
|---|---|
| PubChem CID | 75492526 |
| Molecular Formula | C32H29NO10 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]propanoate |
| SMILES | COC(=O)CC(c1cc2ccccc2n(CC(C)C)c1=O)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C32H29NO10/c1-15(2)14-33-20-7-5-4-6-16(20)10-19(32(33)41)18(12-25(38)42-3)26-23(36)13-24(37)27-28(39)29(40)30(43-31(26)27)17-8-9-21(34)22(35)11-17/h4-11,13,15,18,34-37,40H,12,14H2,1-3H3 |
| InChIKey | AKFIYHMFNQEARU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|