C31H25NO6 — CID 75492565
3-(4-hydroxyphenyl)-10-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione (PubChem CID 75492565) has the molecular formula C31H25NO6 and a molecular weight of 507.54 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-10-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 3-(4-hydroxyphenyl)-10-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 75492565 |
| Molecular Formula | C31H25NO6 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 3-(4-hydroxyphenyl)-10-[1-(2-methylpropyl)-2-oxoquinolin-3-yl]-9,10-dihydropyrano[2,3-f]chromene-4,8-dione |
| SMILES | CC(C)Cn1c(=O)c(C2CC(=O)Oc3ccc4c(=O)c(-c5ccc(O)cc5)coc4c32)cc2ccccc21 |
| InChI | InChI=1S/C31H25NO6/c1-17(2)15-32-25-6-4-3-5-19(25)13-23(31(32)36)22-14-27(34)38-26-12-11-21-29(35)24(16-37-30(21)28(22)26)18-7-9-20(33)10-8-18/h3-13,16-17,22,33H,14-15H2,1-2H3 |
| InChIKey | BDYHXSNNBXKZDK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|