About (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid (PubChem CID 75492839) has the molecular formula C19H28BF3O5
and a molecular weight of 404.23 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid.
Molecular Properties
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid |
| PubChem CID | 75492839 |
| Molecular Formula | C19H28BF3O5 |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cc(OCC2CCOCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H28BF3O5/c1-17(2,24)18(3,4)28-20(25)15-9-14(19(21,22)23)10-16(11-15)27-12-13-5-7-26-8-6-13/h9-11,13,24-25H,5-8,12H2,1-4H3 |
| InChIKey | ZWELSUGSPUXNDH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid?
The IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid (CID 75492839) is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid.
What is the SMILES notation for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid?
The canonical SMILES for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid is CC(C)(O)C(C)(C)OB(O)c1cc(OCC2CCOCC2)cc(C(F)(F)F)c1.
What is the InChIKey of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid?
The InChIKey is ZWELSUGSPUXNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28BF3O5/c1-17(2,24)18(3,4)28-20(25)15-9-14(19(21,22)23)10-16(11-15)27-12-13-5-7-26-8-6-13/h9-11,13,24-25H,5-8,12H2,1-4H3.
What are the key properties of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid?
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid has a molecular weight of 404.23 g/mol, XLogP of 2.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-(oxan-4-ylmethoxy)-5-(trifluoromethyl)phenyl]borinic acid is sourced from PubChem (CID 75492839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).