C16H17N3O3S — CID 75493496
N-[(2,3,4-trimethoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 75493496) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[(2,3,4-trimethoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2,3,4-trimethoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 75493496 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[(2,3,4-trimethoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3sccc23)c(OC)c1OC |
| InChI | InChI=1S/C16H17N3O3S/c1-20-12-5-4-10(13(21-2)14(12)22-3)8-17-15-11-6-7-23-16(11)19-9-18-15/h4-7,9H,8H2,1-3H3,(H,17,18,19) |
| InChIKey | BJHLZASVWYHMST-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |