C7H14ClNO3 — CID 75493650
2-(cyclopropylamino)-3-methoxypropanoic acid;hydrochloride (PubChem CID 75493650) has the molecular formula C7H14ClNO3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 2-(cyclopropylamino)-3-methoxypropanoic acid;hydrochloride.
| Compound Name | 2-(cyclopropylamino)-3-methoxypropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 75493650 |
| Molecular Formula | C7H14ClNO3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-(cyclopropylamino)-3-methoxypropanoic acid;hydrochloride |
| SMILES | COCC(NC1CC1)C(=O)O.Cl |
| InChI | InChI=1S/C7H13NO3.ClH/c1-11-4-6(7(9)10)8-5-2-3-5;/h5-6,8H,2-4H2,1H3,(H,9,10);1H |
| InChIKey | ITIXXXOXSGFDCK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |