About 4-methyl-1,3-thiazol-5-amine;dihydrochloride
4-methyl-1,3-thiazol-5-amine;dihydrochloride (PubChem CID 75493734) has the molecular formula C4H8Cl2N2S
and a molecular weight of 187.09 g/mol. Its IUPAC name is 4-methyl-1,3-thiazol-5-amine;dihydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1,3-thiazol-5-amine;dihydrochloride |
| PubChem CID | 75493734 |
| Molecular Formula | C4H8Cl2N2S |
| Molecular Weight | 187.09 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 4-methyl-1,3-thiazol-5-amine;dihydrochloride |
| SMILES | Cc1ncsc1N.Cl.Cl |
| InChI | InChI=1S/C4H6N2S.2ClH/c1-3-4(5)7-2-6-3;;/h2H,5H2,1H3;2*1H |
| InChIKey | PIJRBGKTDGDATP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,3-thiazol-5-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-thiazol-5-amine;dihydrochloride?
The IUPAC name of 4-methyl-1,3-thiazol-5-amine;dihydrochloride (CID 75493734) is 4-methyl-1,3-thiazol-5-amine;dihydrochloride.
What is the SMILES notation for 4-methyl-1,3-thiazol-5-amine;dihydrochloride?
The canonical SMILES for 4-methyl-1,3-thiazol-5-amine;dihydrochloride is Cc1ncsc1N.Cl.Cl.
What is the InChIKey of 4-methyl-1,3-thiazol-5-amine;dihydrochloride?
The InChIKey is PIJRBGKTDGDATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S.2ClH/c1-3-4(5)7-2-6-3;;/h2H,5H2,1H3;2*1H.
What are the key properties of 4-methyl-1,3-thiazol-5-amine;dihydrochloride?
4-methyl-1,3-thiazol-5-amine;dihydrochloride has a molecular weight of 187.09 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-thiazol-5-amine;dihydrochloride is sourced from PubChem (CID 75493734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).