C12H16F3N3O — CID 75493780
1,2-dimethyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 75493780) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 75493780 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1,2-dimethyl-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NC)NCc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O/c1-16-11(17-2)18-7-9-5-3-4-6-10(9)19-8-12(13,14)15/h3-6H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | QROJQOAOALZWRQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|