About 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate
2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate (PubChem CID 75494970) has the molecular formula C17H21FO4S
and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate |
| PubChem CID | 75494970 |
| Molecular Formula | C17H21FO4S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate |
| SMILES | CC(CS(=O)(=O)c1ccc(F)cc1)C(=O)OC1CC2CCC1C2 |
| InChI | InChI=1S/C17H21FO4S/c1-11(10-23(20,21)15-6-4-14(18)5-7-15)17(19)22-16-9-12-2-3-13(16)8-12/h4-7,11-13,16H,2-3,8-10H2,1H3 |
| InChIKey | KXJIYTBYJWYKSA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate (CID 75494970) is 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate is CC(CS(=O)(=O)c1ccc(F)cc1)C(=O)OC1CC2CCC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate?
The InChIKey is KXJIYTBYJWYKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FO4S/c1-11(10-23(20,21)15-6-4-14(18)5-7-15)17(19)22-16-9-12-2-3-13(16)8-12/h4-7,11-13,16H,2-3,8-10H2,1H3.
What are the key properties of 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate?
2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate has a molecular weight of 340.42 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl 3-(4-fluorophenyl)sulfonyl-2-methylpropanoate is sourced from PubChem (CID 75494970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).