C12H20N6O2S — CID 75495005
8-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 75495005) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 8-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 75495005 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 8-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCc1nc2n(n1)CCCC2NS(=O)(=O)N(C)CCC#N |
| InChI | InChI=1S/C12H20N6O2S/c1-3-11-14-12-10(6-4-9-18(12)15-11)16-21(19,20)17(2)8-5-7-13/h10,16H,3-6,8-9H2,1-2H3 |
| InChIKey | GQTUXICEIXWTDP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |