About 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol
3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol (PubChem CID 75496177) has the molecular formula C13H25NOS
and a molecular weight of 243.42 g/mol. Its IUPAC name is 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol.
Molecular Properties
| Compound Name | 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol |
| PubChem CID | 75496177 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol |
| SMILES | CC1CC(C)CC(NCC2(O)CCSC2)C1 |
| InChI | InChI=1S/C13H25NOS/c1-10-5-11(2)7-12(6-10)14-8-13(15)3-4-16-9-13/h10-12,14-15H,3-9H2,1-2H3 |
| InChIKey | XSWZSWSBUNFPTJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol?
The IUPAC name of 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol (CID 75496177) is 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol.
What is the SMILES notation for 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol?
The canonical SMILES for 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol is CC1CC(C)CC(NCC2(O)CCSC2)C1.
What is the InChIKey of 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol?
The InChIKey is XSWZSWSBUNFPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NOS/c1-10-5-11(2)7-12(6-10)14-8-13(15)3-4-16-9-13/h10-12,14-15H,3-9H2,1-2H3.
What are the key properties of 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol?
3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol has a molecular weight of 243.42 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,5-dimethylcyclohexyl)amino]methyl]thiolan-3-ol is sourced from PubChem (CID 75496177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).