C15H22N6O3S — CID 75496235
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-1-(oxolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 75496235) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-1-(oxolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-1-(oxolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 75496235 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-1-(oxolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | CCc1nc2n(n1)CCCC2NS(=O)(=O)c1cnn(C2CCOC2)c1 |
| InChI | InChI=1S/C15H22N6O3S/c1-2-14-17-15-13(4-3-6-20(15)18-14)19-25(22,23)12-8-16-21(9-12)11-5-7-24-10-11/h8-9,11,13,19H,2-7,10H2,1H3 |
| InChIKey | HTDZIYPCXVNJRP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |