C17H18N4O2S — CID 75496323
1-ethyl-3-(5-phenyl-1,2-oxazol-3-yl)-1-[2-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 75496323) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-ethyl-3-(5-phenyl-1,2-oxazol-3-yl)-1-[2-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-ethyl-3-(5-phenyl-1,2-oxazol-3-yl)-1-[2-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 75496323 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-ethyl-3-(5-phenyl-1,2-oxazol-3-yl)-1-[2-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | CCN(CCc1nccs1)C(=O)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H18N4O2S/c1-2-21(10-8-16-18-9-11-24-16)17(22)19-15-12-14(23-20-15)13-6-4-3-5-7-13/h3-7,9,11-12H,2,8,10H2,1H3,(H,19,20,22) |
| InChIKey | LGGAVYVLJQDQIJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |