About N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide
N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 75496376) has the molecular formula C13H25N3O2S
and a molecular weight of 287.43 g/mol. Its IUPAC name is N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide |
| PubChem CID | 75496376 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C13H25N3O2S/c1-11-3-2-6-16(10-11)13(14)15-9-12-4-7-19(17,18)8-5-12/h11-12H,2-10H2,1H3,(H2,14,15) |
| InChIKey | ZCIXIJRYIACORQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide?
The IUPAC name of N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide (CID 75496376) is N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide.
What is the SMILES notation for N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide?
The canonical SMILES for N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide is CC1CCCN(/C(N)=N/CC2CCS(=O)(=O)CC2)C1.
What is the InChIKey of N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide?
The InChIKey is ZCIXIJRYIACORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2S/c1-11-3-2-6-16(10-11)13(14)15-9-12-4-7-19(17,18)8-5-12/h11-12H,2-10H2,1H3,(H2,14,15).
What are the key properties of N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide?
N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide has a molecular weight of 287.43 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1,1-dioxothian-4-yl)methyl]-3-methylpiperidine-1-carboximidamide is sourced from PubChem (CID 75496376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).