C16H17ClFN3O — CID 75497285
2-[1-(3-chloro-4-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 75497285) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75497285 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC(NCC(=O)NCc1cccnc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClFN3O/c1-11(13-4-5-15(18)14(17)7-13)20-10-16(22)21-9-12-3-2-6-19-8-12/h2-8,11,20H,9-10H2,1H3,(H,21,22) |
| InChIKey | ONFYNHZFKXCUDU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |