C16H12FN3O3 — CID 75497770
4-fluoro-3-[[2-(2H-indazol-3-yl)acetyl]amino]benzoic acid (PubChem CID 75497770) has the molecular formula C16H12FN3O3 and a molecular weight of 313.29 g/mol. Its IUPAC name is 4-fluoro-3-[[2-(2H-indazol-3-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-fluoro-3-[[2-(2H-indazol-3-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 75497770 |
| Molecular Formula | C16H12FN3O3 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-fluoro-3-[[2-(2H-indazol-3-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1[nH]nc2ccccc12)Nc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C16H12FN3O3/c17-11-6-5-9(16(22)23)7-14(11)18-15(21)8-13-10-3-1-2-4-12(10)19-20-13/h1-7H,8H2,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | LDDBTSKNYQHNCQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |