About [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate
[1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate (PubChem CID 75498075) has the molecular formula C16H18F3N3O2
and a molecular weight of 341.33 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate |
| PubChem CID | 75498075 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate |
| SMILES | Cn1cnc2cc(C(=O)OC3CCN(CC(F)(F)F)CC3)ccc21 |
| InChI | InChI=1S/C16H18F3N3O2/c1-21-10-20-13-8-11(2-3-14(13)21)15(23)24-12-4-6-22(7-5-12)9-16(17,18)19/h2-3,8,10,12H,4-7,9H2,1H3 |
| InChIKey | JJYLMNWYHIEMML-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate?
The IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate (CID 75498075) is [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate.
What is the SMILES notation for [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate?
The canonical SMILES for [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate is Cn1cnc2cc(C(=O)OC3CCN(CC(F)(F)F)CC3)ccc21.
What is the InChIKey of [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate?
The InChIKey is JJYLMNWYHIEMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3O2/c1-21-10-20-13-8-11(2-3-14(13)21)15(23)24-12-4-6-22(7-5-12)9-16(17,18)19/h2-3,8,10,12H,4-7,9H2,1H3.
What are the key properties of [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate?
[1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate has a molecular weight of 341.33 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2,2-trifluoroethyl)piperidin-4-yl] 1-methylbenzimidazole-5-carboxylate is sourced from PubChem (CID 75498075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).