About N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide
N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide (PubChem CID 75498380) has the molecular formula C15H21N3O4S
and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide |
| PubChem CID | 75498380 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide |
| SMILES | CCCC1NC(=O)N(Cc2ccc(NS(=O)(=O)CC)cc2)C1=O |
| InChI | InChI=1S/C15H21N3O4S/c1-3-5-13-14(19)18(15(20)16-13)10-11-6-8-12(9-7-11)17-23(21,22)4-2/h6-9,13,17H,3-5,10H2,1-2H3,(H,16,20) |
| InChIKey | SPIOQLAXFQUBMO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide?
The IUPAC name of N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide (CID 75498380) is N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide.
What is the SMILES notation for N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide?
The canonical SMILES for N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide is CCCC1NC(=O)N(Cc2ccc(NS(=O)(=O)CC)cc2)C1=O.
What is the InChIKey of N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide?
The InChIKey is SPIOQLAXFQUBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4S/c1-3-5-13-14(19)18(15(20)16-13)10-11-6-8-12(9-7-11)17-23(21,22)4-2/h6-9,13,17H,3-5,10H2,1-2H3,(H,16,20).
What are the key properties of N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide?
N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide has a molecular weight of 339.42 g/mol, XLogP of 1.67, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]phenyl]ethanesulfonamide is sourced from PubChem (CID 75498380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).