C14H24F3N3O2 — CID 75498616
1-(2-oxoazepan-3-yl)-3-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)urea (PubChem CID 75498616) has the molecular formula C14H24F3N3O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-(2-oxoazepan-3-yl)-3-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)urea.
| Compound Name | 1-(2-oxoazepan-3-yl)-3-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 75498616 |
| Molecular Formula | C14H24F3N3O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(2-oxoazepan-3-yl)-3-(1,1,1-trifluoro-4,4-dimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(NC(=O)NC1CCCCNC1=O)C(F)(F)F |
| InChI | InChI=1S/C14H24F3N3O2/c1-13(2,3)8-10(14(15,16)17)20-12(22)19-9-6-4-5-7-18-11(9)21/h9-10H,4-8H2,1-3H3,(H,18,21)(H2,19,20,22) |
| InChIKey | MQYJUSGZYXBFHY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |