About 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea
3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea (PubChem CID 75499663) has the molecular formula C18H36N4O2
and a molecular weight of 340.51 g/mol. Its IUPAC name is 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea.
Molecular Properties
| Compound Name | 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea |
| PubChem CID | 75499663 |
| Molecular Formula | C18H36N4O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea |
| SMILES | COC1(C)CC(NC(=O)N(C)CCCN2CCN(C)CC2)C1(C)C |
| InChI | InChI=1S/C18H36N4O2/c1-17(2)15(14-18(17,3)24-6)19-16(23)21(5)8-7-9-22-12-10-20(4)11-13-22/h15H,7-14H2,1-6H3,(H,19,23) |
| InChIKey | VRXLAEBSKRGZJU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea?
The IUPAC name of 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea (CID 75499663) is 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea.
What is the SMILES notation for 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea?
The canonical SMILES for 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea is COC1(C)CC(NC(=O)N(C)CCCN2CCN(C)CC2)C1(C)C.
What is the InChIKey of 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea?
The InChIKey is VRXLAEBSKRGZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N4O2/c1-17(2)15(14-18(17,3)24-6)19-16(23)21(5)8-7-9-22-12-10-20(4)11-13-22/h15H,7-14H2,1-6H3,(H,19,23).
What are the key properties of 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea?
3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea has a molecular weight of 340.51 g/mol, XLogP of 1.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-2,2,3-trimethylcyclobutyl)-1-methyl-1-[3-(4-methylpiperazin-1-yl)propyl]urea is sourced from PubChem (CID 75499663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).