About (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide
(1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide (PubChem CID 7550) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
Molecular Properties
| Compound Name | (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide |
| PubChem CID | 7550 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide |
| SMILES | CN(C)C(=O)Oc1ccc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1 |
| InChIKey | VNYBTNPBYXSMOO-UHFFFAOYSA-M |
| XLogP | -2.42 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The IUPAC name of (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide (CID 7550) is (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
What is the SMILES notation for (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The canonical SMILES for (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide is CN(C)C(=O)Oc1ccc[n+](C)c1.[Br-].
What is the InChIKey of (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
The InChIKey is VNYBTNPBYXSMOO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1.
What are the key properties of (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide?
(1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide has a molecular weight of 261.12 g/mol, XLogP of -2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide is sourced from PubChem (CID 7550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).