About Pyridostigmine Bromide
Pyridostigmine Bromide (PubChem CID 7550) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
Molecular Properties
| Compound Name | Pyridostigmine Bromide |
| PubChem CID | 7550 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide |
| SMILES | C[N+]1=CC=CC(=C1)OC(=O)N(C)C.[Br-] |
| InChI | InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1 |
| InChIKey | VNYBTNPBYXSMOO-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 33.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 182 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze Pyridostigmine Bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pyridostigmine Bromide?
The IUPAC name of Pyridostigmine Bromide (CID 7550) is (1-methylpyridin-1-ium-3-yl) N,N-dimethylcarbamate bromide.
What is the SMILES notation for Pyridostigmine Bromide?
The canonical SMILES for Pyridostigmine Bromide is C[N+]1=CC=CC(=C1)OC(=O)N(C)C.[Br-].
What is the InChIKey of Pyridostigmine Bromide?
The InChIKey is VNYBTNPBYXSMOO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1.
What are the key properties of Pyridostigmine Bromide?
Pyridostigmine Bromide has a molecular weight of 261.12 g/mol, XLogP of not available, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Pyridostigmine Bromide is sourced from PubChem (CID 7550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).