About N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide (PubChem CID 75500738) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide.
Molecular Properties
| Compound Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide |
| PubChem CID | 75500738 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide |
| SMILES | COC(C(=O)N(C)C1C2CCOC2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2)15(13-10-11-22-16(13)18)19(3)17(20)14(21-4)12-8-6-5-7-9-12/h5-9,13-16H,10-11H2,1-4H3 |
| InChIKey | DBSCCTZRNJCEMS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide?
The IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide (CID 75500738) is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide.
What is the SMILES notation for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide?
The canonical SMILES for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide is COC(C(=O)N(C)C1C2CCOC2C1(C)C)c1ccccc1.
What is the InChIKey of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide?
The InChIKey is DBSCCTZRNJCEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3/c1-18(2)15(13-10-11-22-16(13)18)19(3)17(20)14(21-4)12-8-6-5-7-9-12/h5-9,13-16H,10-11H2,1-4H3.
What are the key properties of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide?
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide has a molecular weight of 303.40 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methoxy-N-methyl-2-phenylacetamide is sourced from PubChem (CID 75500738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).