About ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate
ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate (PubChem CID 75501249) has the molecular formula C13H10ClF2N3O3
and a molecular weight of 329.69 g/mol. Its IUPAC name is ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate |
| PubChem CID | 75501249 |
| Molecular Formula | C13H10ClF2N3O3 |
| Molecular Weight | 329.69 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(F)c(Cl)cc2F)n[nH]1 |
| InChI | InChI=1S/C13H10ClF2N3O3/c1-2-22-13(21)10-5-11(19-18-10)17-12(20)6-3-9(16)7(14)4-8(6)15/h3-5H,2H2,1H3,(H2,17,18,19,20) |
| InChIKey | DUDOPDAZNHFXHW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate?
The IUPAC name of ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate (CID 75501249) is ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate is CCOC(=O)c1cc(NC(=O)c2cc(F)c(Cl)cc2F)n[nH]1.
What is the InChIKey of ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate?
The InChIKey is DUDOPDAZNHFXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClF2N3O3/c1-2-22-13(21)10-5-11(19-18-10)17-12(20)6-3-9(16)7(14)4-8(6)15/h3-5H,2H2,1H3,(H2,17,18,19,20).
What are the key properties of ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate?
ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate has a molecular weight of 329.69 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4-chloro-2,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 75501249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).