About N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine
N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine (PubChem CID 75501690) has the molecular formula C19H31N3O
and a molecular weight of 317.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine |
| PubChem CID | 75501690 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine |
| SMILES | Cc1ccc(NC2CCN(CCN3CCOCC3)CC2)cc1C |
| InChI | InChI=1S/C19H31N3O/c1-16-3-4-19(15-17(16)2)20-18-5-7-21(8-6-18)9-10-22-11-13-23-14-12-22/h3-4,15,18,20H,5-14H2,1-2H3 |
| InChIKey | HFSWKBWWCOGNRV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine?
The IUPAC name of N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine (CID 75501690) is N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine.
What is the SMILES notation for N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine?
The canonical SMILES for N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine is Cc1ccc(NC2CCN(CCN3CCOCC3)CC2)cc1C.
What is the InChIKey of N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine?
The InChIKey is HFSWKBWWCOGNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O/c1-16-3-4-19(15-17(16)2)20-18-5-7-21(8-6-18)9-10-22-11-13-23-14-12-22/h3-4,15,18,20H,5-14H2,1-2H3.
What are the key properties of N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine?
N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine has a molecular weight of 317.48 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)piperidin-4-amine is sourced from PubChem (CID 75501690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).