C16H17ClFN5O — CID 75502391
N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 75502391) has the molecular formula C16H17ClFN5O and a molecular weight of 349.80 g/mol. Its IUPAC name is N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine.
| Compound Name | N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 75502391 |
| Molecular Formula | C16H17ClFN5O |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | Cc1noc(C)c1CCNCc1cn(-c2ccc(F)c(Cl)c2)nn1 |
| InChI | InChI=1S/C16H17ClFN5O/c1-10-14(11(2)24-21-10)5-6-19-8-12-9-23(22-20-12)13-3-4-16(18)15(17)7-13/h3-4,7,9,19H,5-6,8H2,1-2H3 |
| InChIKey | UQMGWSZHWADPQK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|