About (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide
(2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide (PubChem CID 75502454) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide |
| PubChem CID | 75502454 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide |
| SMILES | CC(C)OCCCCNC(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H28N2O3/c1-11(2)18-8-6-5-7-15-14(17)16-9-12(3)19-13(4)10-16/h11-13H,5-10H2,1-4H3,(H,15,17)/t12-,13+ |
| InChIKey | OPQHMNHIMVMWAY-BETUJISGSA-N |
| XLogP | 2.01 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide?
The IUPAC name of (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide (CID 75502454) is (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide.
What is the SMILES notation for (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide?
The canonical SMILES for (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide is CC(C)OCCCCNC(=O)N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide?
The InChIKey is OPQHMNHIMVMWAY-BETUJISGSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-11(2)18-8-6-5-7-15-14(17)16-9-12(3)19-13(4)10-16/h11-13H,5-10H2,1-4H3,(H,15,17)/t12-,13+.
What are the key properties of (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide?
(2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide has a molecular weight of 272.39 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethyl-N-(4-propan-2-yloxybutyl)morpholine-4-carboxamide is sourced from PubChem (CID 75502454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).