About tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate
tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate (PubChem CID 75502693) has the molecular formula C16H26F2N4O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate |
| PubChem CID | 75502693 |
| Molecular Formula | C16H26F2N4O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2ccn(CC(F)F)n2)CC1 |
| InChI | InChI=1S/C16H26F2N4O2/c1-16(2,3)24-15(23)21-8-4-5-12(6-9-21)19-14-7-10-22(20-14)11-13(17)18/h7,10,12-13H,4-6,8-9,11H2,1-3H3,(H,19,20) |
| InChIKey | ZYGPQUUYZKHEDI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate?
The IUPAC name of tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate (CID 75502693) is tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(Nc2ccn(CC(F)F)n2)CC1.
What is the InChIKey of tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate?
The InChIKey is ZYGPQUUYZKHEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F2N4O2/c1-16(2,3)24-15(23)21-8-4-5-12(6-9-21)19-14-7-10-22(20-14)11-13(17)18/h7,10,12-13H,4-6,8-9,11H2,1-3H3,(H,19,20).
What are the key properties of tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate?
tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate has a molecular weight of 344.41 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[1-(2,2-difluoroethyl)pyrazol-3-yl]amino]azepane-1-carboxylate is sourced from PubChem (CID 75502693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).