About N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide
N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 75503427) has the molecular formula C11H10BrN3O2
and a molecular weight of 296.12 g/mol. Its IUPAC name is N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 75503427 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)c2ncccc2Br)no1 |
| InChI | InChI=1S/C11H10BrN3O2/c1-7-6-9(14-17-7)11(16)15(2)10-8(12)4-3-5-13-10/h3-6H,1-2H3 |
| InChIKey | ZRDDZPDPGZUZOM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide (CID 75503427) is N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)N(C)c2ncccc2Br)no1.
What is the InChIKey of N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The InChIKey is ZRDDZPDPGZUZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN3O2/c1-7-6-9(14-17-7)11(16)15(2)10-8(12)4-3-5-13-10/h3-6H,1-2H3.
What are the key properties of N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide?
N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide has a molecular weight of 296.12 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromo-2-pyridinyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 75503427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).