About 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine
2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine (PubChem CID 75504409) has the molecular formula C7H7F3N2OS
and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine |
| PubChem CID | 75504409 |
| Molecular Formula | C7H7F3N2OS |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine |
| SMILES | FC(F)(F)c1csc(N2CCCO2)n1 |
| InChI | InChI=1S/C7H7F3N2OS/c8-7(9,10)5-4-14-6(11-5)12-2-1-3-13-12/h4H,1-3H2 |
| InChIKey | CCYULYDKZQVYAA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine?
The IUPAC name of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine (CID 75504409) is 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine.
What is the SMILES notation for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine?
The canonical SMILES for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine is FC(F)(F)c1csc(N2CCCO2)n1.
What is the InChIKey of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine?
The InChIKey is CCYULYDKZQVYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2OS/c8-7(9,10)5-4-14-6(11-5)12-2-1-3-13-12/h4H,1-3H2.
What are the key properties of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine?
2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine has a molecular weight of 224.21 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,2-oxazolidine is sourced from PubChem (CID 75504409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).