C11H17NO2S — CID 75504547
N-(1,3-dioxolan-2-ylmethyl)-1-thiophen-2-ylpropan-1-amine (PubChem CID 75504547) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-1-thiophen-2-ylpropan-1-amine.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 75504547 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-1-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(NCC1OCCO1)c1cccs1 |
| InChI | InChI=1S/C11H17NO2S/c1-2-9(10-4-3-7-15-10)12-8-11-13-5-6-14-11/h3-4,7,9,11-12H,2,5-6,8H2,1H3 |
| InChIKey | MTQCIPYNPKJRCN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |