About 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole
6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole (PubChem CID 75505528) has the molecular formula C10H7BrN6O2
and a molecular weight of 323.11 g/mol. Its IUPAC name is 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole |
| PubChem CID | 75505528 |
| Molecular Formula | C10H7BrN6O2 |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ncn(Cc2nc3ccc(Br)cc3[nH]2)n1 |
| InChI | InChI=1S/C10H7BrN6O2/c11-6-1-2-7-8(3-6)14-9(13-7)4-16-5-12-10(15-16)17(18)19/h1-3,5H,4H2,(H,13,14) |
| InChIKey | GAWMKVRIIFHNFM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole?
The IUPAC name of 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole (CID 75505528) is 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole.
What is the SMILES notation for 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole?
The canonical SMILES for 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole is O=[N+]([O-])c1ncn(Cc2nc3ccc(Br)cc3[nH]2)n1.
What is the InChIKey of 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole?
The InChIKey is GAWMKVRIIFHNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN6O2/c11-6-1-2-7-8(3-6)14-9(13-7)4-16-5-12-10(15-16)17(18)19/h1-3,5H,4H2,(H,13,14).
What are the key properties of 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole?
6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole has a molecular weight of 323.11 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1H-benzimidazole is sourced from PubChem (CID 75505528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).