About 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide
4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide (PubChem CID 75505643) has the molecular formula C17H21N3O2S
and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide |
| PubChem CID | 75505643 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCC(CNS(=O)(=O)c2ccc(N)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H21N3O2S/c1-20-11-10-13(16-4-2-3-5-17(16)20)12-19-23(21,22)15-8-6-14(18)7-9-15/h2-9,13,19H,10-12,18H2,1H3 |
| InChIKey | GYYHVZWOUOJANK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide?
The IUPAC name of 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide (CID 75505643) is 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide?
The canonical SMILES for 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide is CN1CCC(CNS(=O)(=O)c2ccc(N)cc2)c2ccccc21.
What is the InChIKey of 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide?
The InChIKey is GYYHVZWOUOJANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2S/c1-20-11-10-13(16-4-2-3-5-17(16)20)12-19-23(21,22)15-8-6-14(18)7-9-15/h2-9,13,19H,10-12,18H2,1H3.
What are the key properties of 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide?
4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide has a molecular weight of 331.44 g/mol, XLogP of 2.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[(1-methyl-3,4-dihydro-2H-quinolin-4-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 75505643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).