About 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol
2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol (PubChem CID 75505877) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol |
| PubChem CID | 75505877 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol |
| SMILES | CCOCCn1nc(C)c(CCO)c1C |
| InChI | InChI=1S/C11H20N2O2/c1-4-15-8-6-13-10(3)11(5-7-14)9(2)12-13/h14H,4-8H2,1-3H3 |
| InChIKey | PWYLIAYMLHCJIR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol?
The IUPAC name of 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol (CID 75505877) is 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol.
What is the SMILES notation for 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol?
The canonical SMILES for 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol is CCOCCn1nc(C)c(CCO)c1C.
What is the InChIKey of 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol?
The InChIKey is PWYLIAYMLHCJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-4-15-8-6-13-10(3)11(5-7-14)9(2)12-13/h14H,4-8H2,1-3H3.
What are the key properties of 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol?
2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol has a molecular weight of 212.29 g/mol, XLogP of 1.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-ethoxyethyl)-3,5-dimethylpyrazol-4-yl]ethanol is sourced from PubChem (CID 75505877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).